|
Kode HS |
200980 |
| Productname | Trans-3-(3-Thienyl)Acrylic Acid |
| Casnumber | 14827-36-4 |
| Molecularformula | C7H6O2S |
| Molecularweight | 154.19 |
| Appearance | Pale yellow solid |
| Meltingpoint | 142-146°C |
| Purity | Typically ≥98% |
| Solubility | Slightly soluble in water |
| Smiles | C1=CSC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/b4-3+ |
| Synonyms | trans-3-(3-Thienyl)acrylic acid; (E)-3-(3-Thienyl)acrylic acid |
| Storagetemperature | Store at 2-8°C |
Sebagai pabrik Asam Trans-3-(3-Thienyl)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of Trans - 3 - (3 - Thienyl)Acrylic Acid in a sealed, labeled chemical - grade container. |
| Storage | Trans - 3 - (3 - Thienyl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight and heat sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents or bases, in a well - ventilated area to ensure safety. |
| Shipping | Trans - 3 - (3 - Thienyl)Acrylic Acid is shipped with strict safety protocols. Packed in air - tight, corrosion - resistant containers, it's transported by specialized carriers compliant with chemical shipping regulations to ensure secure delivery. |
Harga Asam Trans-3-(3-Thienyl)Akrilat yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
