|
Kode HS |
377670 |
| Cas Number | 109-17-1 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 390.43 g/mol |
| Appearance | Clear, colorless to pale yellow liquid |
| Odor | Mild ester-like odor |
| Boiling Point | Approx. 220°C (428°F) |
| Density | 1.089 g/cm³ at 25°C |
| Viscosity | 110-135 mPa·s at 25°C |
| Flash Point | 140°C (284°F) |
| Solubility | Insoluble in water; soluble in organic solvents |
| Refractive Index | 1.461 at 20°C |
| Melting Point | -38°C |
| Purity | Typically ≥ 98% |
| Chemical Structure | CH2=C(CH3)COO(CH2CH2O)4COC(CH3)=CH2 |
| Stability | Stable under recommended storage conditions |
Sebagai pabrik Tetraethylene Glycol Dimethacrylate yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | Tetraethylene Glycol Dimethacrylate in 5 - liter containers, securely packaged. |
| Storage | Tetraethylene Glycol Dimethacrylate should be stored in a cool, dry, well - ventilated area. Keep it away from heat sources, flames, and oxidizing agents. Store in a tightly - sealed container to prevent evaporation and contact with air. Since it is a flammable and reactive chemical, ensure storage conditions minimize the risk of ignition and unwanted reactions. |
| Shipping | Tetraethylene Glycol Dimethacrylate is shipped in well - sealed containers, compliant with chemical transportation regulations. It's carefully packaged to prevent leakage, transported under proper conditions to maintain stability during transit. |
Harga Tetraethylene Glycol Dimethacrylate yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
