|
Kode HS |
812862 |
| Iupac Name | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 1219801-51-6 |
| Appearance | Yellow to orange solid |
| Melting Point | Approx. 132-134°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1CC(CC=C1[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h4-5,7H,1-3,6H2,(H,11,12)/b5-4+ |
| Logp | 1.7 |
| Boiling Point | Decomposes before boiling |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, protected from light |
| Synonyms | trans-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
Sebagai pabrik Asam Akrilik (E)-3-(5-Nitrocyclohex-1-En-1-Yl) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of (E)-3-(5 - Nitrocyclohex - 1 - en - 1 - yl)acrylic acid in sealed chemical - grade bag. |
| Storage | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents and bases, to avoid chemical reactions. |
| Shipping | (E)-3-(5 - Nitrocyclohex-1-en-1-yl)acrylic acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills, in containers suitable for its chemical nature, and transported by approved carriers. |
Harga Asam Akrilik (E)-3-(5-Nitrocyclohex-1-En-1-Yl) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
