|
Kode HS |
582074 |
| Productname | Acrylic Acid 2,2,3,3,4,4,5,5-Octafluoropentyl Ester~1H,1H,5H-Perfluoro-1-Pentyl Acrylate |
| Casnumber | 87048-35-5 |
| Molecularformula | C8H6F8O2 |
| Molecularweight | 282.12 |
| Appearance | Colorless liquid |
| Boilingpoint | 108-110°C at 13 mmHg |
| Density | 1.43 g/cm3 |
| Refractiveindex | n20/D 1.355 |
| Flashpoint | >110°C |
| Solubility | Insoluble in water |
| Purity | Typically ≥98% |
| Storagetemperature | 2-8°C |
| Smiles | C=CC(=O)OCCCC(C(F)(F)C(F)(F)F)F |
| Inchikey | QIWJQNGQQOIATQ-UHFFFAOYSA-N |
Sebagai pabrik Asam Akrilik 2,2,3,3,4,4,5,5-Oktafluoropentil Ester~1H,1H,5H-Perfluoro-1-Pentil Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester in sealed, labeled container. |
| Storage | Store "Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester~1H,1H,5H - Perfluoro - 1 - Pentyl Acrylate" in a cool, well - ventilated area away from heat, sparks, and open flames. Keep it in a tightly - sealed container to prevent vapor release. Store separately from oxidizing agents and incompatible substances to avoid potential reactions. |
| Shipping | Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester ~ 1H,1H,5H - Perfluoro - 1 - Pentyl Acrylate is shipped in specialized containers, ensuring proper containment and safety, compliant with chemical transportation regulations. |
Harga Asam Akrilik 2,2,3,3,4,4,5,5-Oktafluoropentil Ester~1H,1H,5H-Perfluoro-1-Pentil Akrilat yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com