|
Kode HS |
936910 |
| Product Name | 3B-Indole Acrylic Acid |
| Cas Number | 830-96-6 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Appearance | White to off-white powder |
| Melting Point | 153-156°C |
| Solubility | Slightly soluble in water, soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C |
| Synonyms | Indole-3-acrylic acid, 3-Indoleacrylic acid |
| Pka | 4.6 (carboxyl group) |
| Smiles | C1=CC=C2C(=C1)C=CN2C=CC(=O)O |
| Application | Intermediate in organic synthesis and research |
Sebagai pabrik Asam Akrilik 3B-Indol yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100 - gram pack of 3 - Indole Acrylic Acid in air - tight, chemical - resistant packaging. |
| Storage | 3 - Indole Acrylic Acid should be stored in a cool, dry place, away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and incompatible substances. This helps maintain its chemical integrity and reduces the risk of degradation or dangerous reactions. |
| Shipping | 3 - Indole Acrylic Acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills and damage, often in sealed containers. Shipment may involve temperature - controlled environments if required for stability. |
Harga Asam Akrilik 3B-Indol yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
