|
Kode HS |
555529 |
| Product Name | 3-Methoxyacrylic Acid Methyl Ester |
| Cas Number | 2706-99-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 128-130°C (at 760 mmHg) |
| Density | 1.065 g/cm3 (at 25°C) |
| Refractive Index | 1.422 (at 20°C) |
| Flash Point | 44°C |
| Purity | Typically ≥98% |
| Solubility | Soluble in organic solvents like ethanol and ether |
| Smiles | COC(=C)C(=O)OC |
| Inchi | InChI=1S/C5H8O3/c1-7-4-3-5(6)8-2/h3-4H,1-2H3 |
Sebagai pabrik 3-Methoxyacrylic Acid Methyl Ester yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | |
| Storage | |
| Shipping |
Harga 3-Methoxyacrylic Acid Methyl Ester yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
