|
Kode HS |
543938 |
| Chemical Name | 3-(Indol-3-Yl)Acrylic Acid |
| Synonyms | Indole-3-acrylic acid |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Cas Number | 523-09-9 |
| Appearance | White to off-white crystalline powder |
| Melting Point | 193-196°C |
| Solubility | Slightly soluble in water; soluble in ethanol, DMSO |
| Purity | Typically ≥98% |
| Storage Conditions | Store at 2-8°C, protected from light |
| Pka | Approx. 4.28 (carboxyl group) |
| Smiles | C1=CC=C2C(=C1)C=CN2C=CC(=O)O |
| Inchi | InChI=1S/C11H9NO2/c13-11(14)6-8-7-12-10-5-3-2-4-9(8)10/h2-7,12H,1H2,(H,13,14) |
Sebagai pabrik Asam 3-(Indol-3-Yl)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of 3-(Indol-3-Yl)Acrylic Acid packaged in a sealed, chemical - resistant bag. |
| Storage | 3-(Indol-3-Yl)Acrylic Acid should be stored in a cool, dry place, away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizing agents, in a location with proper ventilation to ensure safety. |
| Shipping | 3-(Indol-3-Yl)Acrylic Acid is shipped in sealed, corrosion - resistant containers. It's carefully packaged to prevent breakage and exposure. Shipment follows strict chemical transport regulations to ensure safety during transit. |
Harga Asam Akrilik 3-(Indol-3-Yl) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
E-mail: sales3@ascent-chem.com