|
Kode HS |
979005 |
| Chemical Name | 3-Imidazol-4-Ylacrylic Acid |
| Molecular Formula | C6H6N2O2 |
| Molar Mass | 138.12 g/mol |
| Cas Number | 2736-23-4 |
| Appearance | White to off-white solid |
| Solubility | Soluble in water and common organic solvents |
| Melting Point | Approx. 190-192°C |
| Purity | Typically ≥98% |
| Storage Conditions | Store in a cool, dry place, tightly closed |
| Pka | Approx. 2.3 (carboxylic acid) |
| Synonyms | 3-(1H-imidazol-4-yl)acrylic acid |
| Smiles | C1=CN=CN1C=CC(=O)O |
| Inchi | InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,9,10)(H,7,8) |
| Hazard Statement | Generally regarded as non-hazardous under typical laboratory conditions |
Sebagai pabrik Asam 3-Imidazol-4-Ylacrylic yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | |
| Storage | |
| Shipping |
Harga Asam 3-Imidazol-4-Ylacrylic yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
