|
Kode HS |
514083 |
| Chemical Name | 3-Furanylacrylic Acid |
| Cas Number | 609-97-8 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 148-150 °C |
| Solubility | Slightly soluble in water |
| Density | 1.371 g/cm3 |
| Pubchem Cid | 12611 |
| Smiles | C1=COC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O3/c8-7(9)3-6-2-1-5-10-6/h1-5H,(H,8,9) |
| Synonyms | 3-(Furan-3-yl)acrylic acid |
| Storage Conditions | Store at room temperature, tightly closed |
Sebagai pabrik Asam 3-Furanylacrylic yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of 3 - Furanylacrylic Acid packaged in a sealed, air - tight plastic bag. |
| Storage | 3 - Furanylacrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases. Ideal storage temperature is around room temperature, avoiding extreme hot or cold conditions. |
| Shipping | 3 - Furanylacrylic Acid is shipped in sealed, corrosion - resistant containers. Packaging ensures protection from moisture and physical damage. Shipments follow strict chemical transportation regulations for safe delivery. |
Harga Asam 3-Furanylacrylic yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
