|
Kode HS |
831550 |
| Chemical Name | 3-Benzoylacrylic Acid |
| Cas Number | 614-61-9 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 |
| Appearance | White to off-white powder |
| Melting Point | 185-187°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Purity | Typically ≥98% |
| Storage Temperature | Store at 2-8°C |
| Synonyms | Benzalmalonic acid |
| Inchi | InChI=1S/C10H8O3/c11-9(7-8-4-2-1-3-5-8)6-10(12)13/h1-7H,(H,12,13) |
| Smiles | C1=CC=C(C=C1)C(=O)C=CC(=O)O |
| Assay Method | HPLC |
Sebagai pabrik Asam 3-Benzoylacrylic yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100 - gram pack of 3 - Benzoylacrylic Acid in sealed, chemical - resistant packaging. |
| Storage | 3 - Benzoylacrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | 3-Benzoylacrylic Acid is shipped in well - sealed containers, often lined to prevent contact with external elements. Shipment follows strict chemical transport regulations to ensure safety during transit, safeguarding both handlers and the environment. |
Harga Asam 3-Benzoylacrylic yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
