|
Kode HS |
787814 |
| Product Name | 3-(4-Nitrophenyl)Acrylic Acid |
| Cas Number | 104-91-6 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Appearance | Yellow to orange powder |
| Melting Point | 202-204 °C |
| Solubility | Slightly soluble in water; soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Iupac Name | (E)-3-(4-nitrophenyl)prop-2-enoic acid |
| Synonyms | p-Nitrocinnamic acid |
| Smiles | C1=CC(=CC=C1C=CC(=O)O)[N+](=O)[O-] |
| Inchikey | FBUBBHPXCVIZCF-UHFFFAOYSA-N |
| Storage Conditions | Store at room temperature, protected from moisture and light |
Sebagai pabrik Asam 3-(4-Nitrofenil)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of 3-(4 - Nitrophenyl)Acrylic Acid packaged in a sealed, chemical - resistant container. |
| Storage | 3-(4 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air. Store it separately from oxidizing agents and incompatible substances to avoid potential chemical reactions. Suitable storage temperature is typically around 2 - 8°C if possible for long - term stability. |
| Shipping | 3-(4 - Nitrophenyl)Acrylic Acid is shipped in accordance with chemical regulations. Packed securely in suitable containers, it's transported by carriers trained in handling hazardous chemicals to ensure safe and proper delivery. |
Harga Asam Akrilik 3-(4-Nitrofenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
