|
Kode HS |
727609 |
| Iupac Name | 3-(4-Hydroxy-3-methoxyphenyl)acrylic acid |
| Common Name | Ferulic acid |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.18 g/mol |
| Cas Number | 1135-24-6 |
| Appearance | Off-white to yellow crystalline powder |
| Melting Point | 172-174°C |
| Solubility In Water | Slightly soluble |
| Pka | 4.58 |
| Smiles | COC1=CC=C(C=C1O)C=CC(=O)O |
| Inchi | InChI=1S/C10H10O4/c1-14-9-5-7(2-3-10(12)13)4-8(11)6-9/h2-6,11H,1H3,(H,12,13) |
| Density | 1.34 g/cm³ |
| Logp | 1.5 |
| Refractive Index | 1.579 |
Sebagai pabrik Asam 3-(4-Hidroksi-3-Metoksifenil)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of 3-(4 - Hydroxy - 3 - Methoxyphenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Hydroxy - 3 - Methoxyphenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could lead to degradation. Store it separately from incompatible substances to avoid potential chemical reactions. |
| Shipping | 3-(4 - Hydroxy - 3 - Methoxyphenyl)Acrylic Acid is shipped in properly sealed containers, following strict chemical transport regulations. Packaging ensures protection from damage and leakage during transit. |
Harga Asam Akrilik 3-(4-Hidroksi-3-Metoksifenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
