|
Kode HS |
875699 |
| Productname | 3-(4-Chloro-3-Nitrophenyl)Acrylic Acid |
| Casnumber | 32727-66-3 |
| Molecularformula | C9H6ClNO4 |
| Molecularweight | 227.6 g/mol |
| Appearance | Yellow solid |
| Meltingpoint | 181-185 °C |
| Solubility | Slightly soluble in water |
| Purity | Typically ≥98% |
| Smiles | C1=CC(=C(C=C1Cl)N(=O)=O)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-8-4-6(1-2-9(12)13)3-7(5-8)11(14)15/h1-5H,(H,12,13) |
| Storagetemperature | 2-8 °C |
| Synonyms | 4-Chloro-3-nitrocinnamic acid |
Sebagai pabrik Asam Akrilik 3-(4-Kloro-3-Nitrofenil) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing or reducing agents, to avoid chemical reactions. |
| Shipping | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. Special handling precautions are taken due to its chemical nature, following strict regulations to ensure safe transportation. |
Harga Asam Akrilik 3-(4-Kloro-3-Nitrofenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
