|
Kode HS |
485792 |
| Chemical Name | 3-(4-Chloro-2-Fluorophenyl)Acrylic Acid |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.6 g/mol |
| Cas Number | 870718-85-3 |
| Appearance | White to off-white solid |
| Purity | Typically ≥98% |
| Solubility | Soluble in organic solvents (e.g., DMSO, methanol) |
| Storage Conditions | Store at room temperature, away from moisture and light |
| Smiles | C1=CC(=C(C=C1Cl)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClFO2/c10-7-3-1-6(9(12)13)2-8(11)5-4-7/h1-5H,(H,12,13) |
Sebagai pabrik Asam 3-(4-Kloro-2-Fluorofenil)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of 3-(4 - Chloro - 2 - Fluorophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 2 - Fluorophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizers or bases, to ensure safety and maintain its chemical integrity. |
| Shipping | 3-(4 - Chloro - 2 - fluorophenyl)acrylic acid is shipped in properly sealed containers. It follows strict chemical transportation regulations to ensure safe transit, avoiding exposure to incompatible substances. |
Harga Asam Akrilik 3-(4-Kloro-2-Fluorofenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
