|
Kode HS |
167281 |
| Chemical Name | 3-(3-Pyridyl)acrylic acid |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Cas Number | 7406-77-9 |
| Appearance | White to off-white solid |
| Melting Point | 149-153°C |
| Solubility | Soluble in water and organic solvents |
| Smiles | C1=CC(=CN=C1)C=CC(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11) |
| Synonyms | beta-(3-Pyridyl)acrylic acid |
| Purity | Typically ≥98% |
| Storage Conditions | Store at room temperature in a dry place |
Sebagai pabrik Asam 3-(3-Piridil)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of 3-(3 - Pyridyl)Acrylic Acid packaged in a sealed, chemical - resistant bag. |
| Storage | 3-(3 - Pyridyl)Acrylic Acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to ensure its stability and integrity over time. |
| Shipping | 3-(3 - Pyridyl)Acrylic Acid is shipped in well - sealed containers, safeguarded against physical damage. Transport follows strict chemical safety regulations, ensuring secure delivery to prevent any leakage or hazards during transit. |
Harga Asam Akrilik 3-(3-Piridil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
