|
Kode HS |
921485 |
| Chemical Name | 3-(1H-Indol-3-yl)acrylic acid |
| Synonyms | Indole-3-acrylic acid, 3-Indoleacrylic acid |
| Molecular Formula | C11H9NO2 |
| Molar Mass | 187.2 g/mol |
| Cas Number | 100-25-4 |
| Appearance | Off-white to light yellow powder |
| Melting Point | 194-196 °C |
| Solubility In Water | Slightly soluble |
| Structure Type | Aromatic carboxylic acid |
| Smiles | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
| Inchi | InChI=1S/C11H9NO2/c13-11(14)6-8-7-12-10-5-3-2-4-9(8)10/h2-7,12H,1H2,(H,13,14) |
| Storage Conditions | Store at room temperature, protected from light and moisture |
Sebagai pabrik Asam Akrilik 3-(1H-Indol-3-Yl) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | |
| Storage | |
| Shipping |
Harga Asam Akrilik 3-(1H-Indol-3-Yl) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
