|
Kode HS |
838432 |
| Iupac Name | (2E)-3-(pyridin-3-yl)acrylic acid |
| Cas Number | 51762-05-9 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 165-167°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CN=C1)/C=C/C(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-5-7-2-1-3-9-6-7/h1-6H,(H,10,11)/b5-4+ |
| Pubchem Cid | 166713 |
| Pka | 4.43 (carboxylic acid group) |
| Synonyms | β-(3-Pyridyl)acrylic acid; 3-Pyridylacrylic acid |
| Logp | 0.97 |
Sebagai pabrik Asam Akrilik (2E)-3-(Pyridin-3-Yl) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of (2E)-3-(Pyridin-3-yl)acrylic acid in sealed, chemical - resistant bags. |
| Storage | (2E)-3-(Pyridin - 3 - yl)acrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent contact with moisture and air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3-(Pyridin-3-yl)acrylic acid is shipped in well - sealed containers, compliant with chemical transport regulations. Special care is taken to prevent damage, with proper cushioning and secure packaging for safe transit. |
Harga Asam Akrilik (2E)-3-(Pyridin-3-Yl) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
