|
Kode HS |
183118 |
| Iupac Name | (2E)-3-Ethoxyacrylic acid |
| Cas Number | 53521-53-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 92-94 °C at 20 mmHg |
| Density | 1.096 g/cm³ (approximate) |
| Solubility In Water | Moderately soluble |
| Smiles | CCOC=CC(=O)O |
| Inchi | InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3,(H,6,7)/b4-3+ |
| Refractive Index | 1.440 (approximate) |
| Ec Number | 258-396-3 |
Sebagai pabrik Asam (2E)-3-Ethoxyacrylic yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of (2E)-3 - Ethoxyacrylic Acid in a sealed, corrosion - resistant plastic bottle. |
| Storage | (2E)-3 - Ethoxyacrylic acid should be stored in a cool, dry, well - ventilated area, away from heat sources and ignition points. Keep it in a tightly sealed container to prevent contact with air and moisture, which could potentially cause degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3 - Ethoxyacrylic Acid is shipped in carefully sealed, corrosion - resistant containers. Shipment adheres to strict chemical transportation regulations, ensuring safe transit to prevent spills and maintain product integrity. |
Harga Asam (2E)-3-Etoksiakrilat yang kompetitif dan sesuai dengan anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
