|
Kode HS |
317786 |
| Iupac Name | (2E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 119224-15-6 |
| Appearance | Solid (exact color may vary, typically off-white to light yellow) |
| Solubility | Slightly soluble in water, more soluble in organic solvents |
| Boiling Point | Decomposes before boiling |
| Smiles | C1CC(=CC(C1)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-6-7-3-1-2-4-8(7)10(13)14/h5-6H,1-4H2,(H,11,12)/b6-5+ |
| Pubchem Cid | 20071461 |
| Storage Conditions | Store in a cool, dry place, away from light and incompatible substances |
| Functional Groups | Nitro, carboxylic acid, alkene, cyclohexene |
Sebagai pabrik Asam Akrilik (2E)-3-(5-Nitrocyclohex-1-Enyl) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | |
| Storage | |
| Shipping |
Harga Asam Akrilik (2E)-3-(5-Nitrocyclohex-1-Enyl) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
