|
Kode HS |
317786 |
| Iupac Name | (2E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 119224-15-6 |
| Appearance | Solid (exact color may vary, typically off-white to light yellow) |
| Solubility | Slightly soluble in water, more soluble in organic solvents |
| Boiling Point | Decomposes before boiling |
| Smiles | C1CC(=CC(C1)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-6-7-3-1-2-4-8(7)10(13)14/h5-6H,1-4H2,(H,11,12)/b6-5+ |
| Pubchem Cid | 20071461 |
| Storage Conditions | Store in a cool, dry place, away from light and incompatible substances |
| Functional Groups | Nitro, carboxylic acid, alkene, cyclohexene |
Sebagai pabrik Asam Akrilik (2E)-3-(5-Nitrocyclohex-1-Enyl) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | Packaging: 1 kg of (2E)-3-(5 - Nitrocyclohex - 1 - enyl)acrylic acid in airtight container. |
| Storage | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to chemical degradation. Store it separately from incompatible substances like strong oxidizers and bases to ensure safety. |
| Shipping | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid is shipped in properly sealed, corrosion - resistant containers. Shipment adheres to strict chemical transport regulations, ensuring safety during transit. |
Harga Asam Akrilik (2E)-3-(5-Nitrocyclohex-1-Enyl) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
