|
Kode HS |
446265 |
| Iupac Name | (2E)-3-(4-chloro-3-nitrophenyl)acrylic acid |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Cas Number | 32726-82-8 |
| Appearance | Yellow crystalline powder |
| Melting Point | 220-222°C |
| Solubility | Slightly soluble in water; soluble in organic solvents like DMSO and methanol |
| Smiles | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-7-3-1-6(9(12)13)2-8(7)11(14)15/h1-3H,(H,12,13)/b6-1+ |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C, protected from light and moisture |
| Pka | 4.2 (for the carboxylic acid group) |
| Hazard Statements | H315, H319, H335 |
Sebagai pabrik Asam Akrilik (2E)-3-(4-Kloro-3-Nitrofenil) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | |
| Storage | |
| Shipping |
Harga Asam Akrilik (2E)-3-(4-Kloro-3-Nitrofenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
