|
Kode HS |
475587 |
| Iupac Name | (2E)-3-(4-Bromo-2-chlorophenyl)acrylic acid |
| Molecular Formula | C9H6BrClO2 |
| Molecular Weight | 261.50 |
| Cas Number | 141995-96-2 |
| Appearance | Off-white to light brown solid |
| Melting Point | 173-176°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Br)Cl |
| Inchi | InChI=1S/C9H6BrClO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| Purity | Typically >98% |
| Storage Condition | Store at 2-8°C, protected from light |
Sebagai pabrik Asam Akrilik (2E)-3-(4-Bromo-2-Klorofenil) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid in sealed, labeled containers. |
| Storage | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents or bases, to ensure its chemical stability. |
| Shipping | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safety during transit to prevent spills and environmental exposure. |
Harga Asam Akrilik (2E)-3-(4-Bromo-2-Klorofenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
