|
Kode HS |
248463 |
| Iupac Name | (2E)-3-(3-methylthiophen-2-yl)prop-2-enoic acid |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.21 g/mol |
| Cas Number | 50918-02-6 |
| Appearance | Solid (typically powder or crystalline) |
| Melting Point | Approximately 150-152 °C |
| Boiling Point | Decomposition before boiling |
| Solubility In Water | Poorly soluble |
| Smiles | CC1=CSC=C1C=CC(=O)O |
| Inchi | InChI=1S/C8H8O2S/c1-6-3-5-11-7(6)2-4-8(9)10/h2-5H,1H3,(H,9,10)/b4-2+ |
| Synonyms | 3-(3-Methyl-2-thienyl)acrylic acid |
| Purity | Typically ≥ 98% (depending on supplier) |
Sebagai pabrik Asam (2E)-3-(3-Metil-2-Tienil)Akrilat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of (2E)-3-(3 - Methyl - 2 - Thienyl)Acrylic Acid in a sealed, labeled container. |
| Storage | (2E)-3-(3 - Methyl - 2 - thienyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store in a well - ventilated area, separate from incompatible substances like strong oxidizing agents. Avoid exposure to sunlight to maintain its chemical stability. |
| Shipping | (2E)-3-(3 - Methyl - 2 - thienyl)acrylic acid is shipped in sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipments follow regulations for chemical transportation to ensure safety. |
Harga Asam Akrilik (2E)-3-(3-Metil-2-Tienil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
E-mail: sales3@ascent-chem.com