|
Kode HS |
364388 |
| Iupac Name | (2E)-3-(3-chloro-4-fluorophenyl)prop-2-enoic acid |
| Cas Number | 885277-12-7 |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.59 |
| Appearance | White to off-white solid |
| Melting Point | 118-122°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Cl)F |
| Inchi | InChI=1S/C9H6ClFO2/c10-7-4-6(2-3-8(7)11)1-5-9(12)13/h1-5H,(H,12,13)/b5-1+ |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, keep container tightly closed |
| Synonyms | 3-(3-chloro-4-fluorophenyl)acrylic acid |
Sebagai pabrik Asam Akrilik (2E)-3-(3-Chloro-4-Fluorophenyl) yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 500g of (2E)-3-(3 - Chloro - 4 - Fluorophenyl)Acrylic Acid in sealed plastic bags. |
| Storage | (2E)-3-(3 - Chloro - 4 - fluorophenyl)acrylic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizers or bases, to avoid chemical reactions. |
| Shipping | (2E)-3-(3 - Chloro - 4 - fluorophenyl)acrylic acid is shipped in accordance with chemical safety regulations. It's packaged securely to prevent leakage, transported by carriers experienced in handling such chemicals, ensuring proper storage during transit. |
Harga Asam Akrilik (2E)-3-(3-Kloro-4-Fluorofenil) yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
