|
Kode HS |
423316 |
| Product Name | (2E)-3-(2,5-Difluorophenyl)Acrylic Acid |
| Synonym | Trans-3-(2,5-Difluorophenyl)Prop-2-Enoic Acid |
| Cas Number | 60498-36-0 |
| Molecular Formula | C9H6F2O2 |
| Molecular Weight | 184.14 |
| Appearance | White to off-white solid |
| Melting Point | 143-145°C |
| Solubility | Slightly soluble in water; soluble in organic solvents |
| Purity | Typically ≥98% |
| Smiles | C1=CC(=C(C=C1F)C=CC(=O)O)F |
| Inchi | InChI=1S/C9H6F2O2/c10-7-2-1-6(5-8(7)11)3-4-9(12)13/h1-5H,(H,12,13)/b4-3+ |
| Storage Conditions | Store at room temperature, protected from light and moisture |
Sebagai pabrik Asam (2E)-3-(2,5-Difluorofenil)Akrilat, Asam Trans-3-(2,5-Difluorofenil)Prop-2-Enoat yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | |
| Storage | |
| Shipping |
Harga kompetitif Asam (2E)-3-(2,5-Difluorofenil)Akrilat, Asam Trans-3-(2,5-Difluorofenil)Prop-2-Enoat yang sesuai dengan anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
