|
Kode HS |
760878 |
| Cas Number | 1443-98-7 |
| Molecular Formula | C7H6O2S |
| Molecular Weight | 154.19 |
| Iupac Name | 2-thiophen-2-ylprop-2-enoic acid |
| Appearance | White to beige powder |
| Melting Point | 143-146°C |
| Solubility | Slightly soluble in water |
| Density | 1.34 g/cm3 (estimated) |
| Smiles | C=CC(=O)O c1cccs1 |
| Inchi | InChI=1S/C7H6O2S/c8-7(9)4-5-6-2-1-3-10-6/h1-5H,(H,8,9) |
| Synonyms | 2-Thienylacrylic acid; (E)-3-(2-Thienyl)acrylic acid |
Sebagai pabrik Asam 2-Thienylacrylic yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 2 - Thienylacrylic Acid packaged in 1 - kg bags for secure storage and transport. |
| Storage | 2 - Thienylacrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to avoid chemical reactions. |
| Shipping | 2 - Thienylacrylic acid is shipped in well - sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipment follows strict chemical transport regulations to ensure safety during transit. |
Harga Asam 2-Thienylacrylic yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
Email: sales3@ascent-chem.com
