|
Kode HS |
681165 |
| Productname | 2-Cyano-3-(1-Naphthyl)Acrylic Acid Methyl Ester |
| Casnumber | 119772-34-6 |
| Molecularformula | C15H11NO2 |
| Molecularweight | 237.25 g/mol |
| Appearance | Light yellow to yellow solid |
| Purity | Typically ≥98% |
| Meltingpoint | 102-104°C |
| Solubility | Soluble in common organic solvents (e.g., DMSO, ethanol) |
| Storagetemperature | Store at 2-8°C |
| Synonyms | Methyl 2-cyano-3-(1-naphthyl)acrylate |
| Smiles | COC(=O)C(C#N)=C1C=CC=CC2=CC=CC=C21 |
| Inchi | InChI=1S/C15H11NO2/c1-18-15(17)14(10-16)13-9-5-7-11-6-2-3-8-12(11)13/h2-9H,1H3 |
Sebagai pabrik 2-Cyano-3-(1-Naphthyl)Acrylic Acid Methyl Ester yang terakreditasi, kami menerapkan protokol kualitas yang ketat—setiap batch menjalani pengujian ketat untuk memastikan standar kemanjuran dan keamanan yang konsisten.
| Packing | 100g of 2 - Cyano - 3 - (1 - Naphthyl)Acrylic Acid Methyl Ester in a sealed glass vial. |
| Storage | 2 - Cyano - 3 - (1 - Naphthyl)Acrylic Acid Methyl Ester should be stored in a cool, dry, well - ventilated area. Keep it away from heat sources, open flames, and oxidizing agents. Store in a tightly - sealed container to prevent moisture absorption and degradation. Avoid exposure to sunlight. This storage method helps maintain its chemical stability. |
| Shipping | 2 - Cyano - 3 - (1 - Naphthyl)Acrylic Acid Methyl Ester is shipped in sealed, corrosion - resistant containers. Transport follows strict chemical safety regulations, ensuring proper handling to prevent leakage and maintain product integrity. |
Harga 2-Cyano-3-(1-Naphthyl)Acrylic Acid Methyl Ester yang kompetitif sesuai anggaran Anda—persyaratan fleksibel dan penawaran khusus untuk setiap pesanan.
Untuk sampel, harga, atau informasi lebih lanjut, silakan hubungi kami di+8615365186327 atau surat ke sales3@ascent-chem.com.
Kami akan menanggapi Anda sesegera mungkin.
Telp: +8615365186327
E-mail: sales3@ascent-chem.com